C18H28N6O8S — CID 18265951
4-amino-5-[[1-[[1-[(1-carboxy-2-sulfanylethyl)amino]-3-hydroxy-1-oxobutan-2-yl]amino]-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]amino]-5-oxopentanoic acid (PubChem CID 18265951) has the molecular formula C18H28N6O8S and a molecular weight of 488.52 g/mol. Its IUPAC name is 4-amino-5-[[1-[[1-[(1-carboxy-2-sulfanylethyl)amino]-3-hydroxy-1-oxobutan-2-yl]amino]-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]amino]-5-oxopentanoic acid.
| Compound Name | 4-amino-5-[[1-[[1-[(1-carboxy-2-sulfanylethyl)amino]-3-hydroxy-1-oxobutan-2-yl]amino]-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 18265951 |
| Molecular Formula | C18H28N6O8S |
| Molecular Weight | 488.52 g/mol |
| Exact Mass | 488.17 |
| IUPAC Name | 4-amino-5-[[1-[[1-[(1-carboxy-2-sulfanylethyl)amino]-3-hydroxy-1-oxobutan-2-yl]amino]-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]amino]-5-oxopentanoic acid |
| SMILES | CC(O)C(NC(=O)C(Cc1cnc[nH]1)NC(=O)C(N)CCC(=O)O)C(=O)NC(CS)C(=O)O |
| InChI | InChI=1S/C18H28N6O8S/c1-8(25)14(17(30)23-12(6-33)18(31)32)24-16(29)11(4-9-5-20-7-21-9)22-15(28)10(19)2-3-13(26)27/h5,7-8,10-12,14,25,33H,2-4,6,19H2,1H3,(H,20,21)(H,22,28)(H,23,30)(H,24,29)(H,26,27)(H,31,32) |
| InChIKey | KSAFHXSKNPKXRB-UHFFFAOYSA-N |
| XLogP | -3.01 |
| TPSA | 236.83 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.52 |
| LogP ≤ 5 | -3.01 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|