C19H15BrF3N3O — CID 18267919
N-(4-bromo-3-methylphenyl)-5-methyl-1-[3-(trifluoromethyl)phenyl]pyrazole-4-carboxamide (PubChem CID 18267919) has the molecular formula C19H15BrF3N3O and a molecular weight of 438.25 g/mol. Its IUPAC name is N-(4-bromo-3-methylphenyl)-5-methyl-1-[3-(trifluoromethyl)phenyl]pyrazole-4-carboxamide.
| Compound Name | N-(4-bromo-3-methylphenyl)-5-methyl-1-[3-(trifluoromethyl)phenyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 18267919 |
| Molecular Formula | C19H15BrF3N3O |
| Molecular Weight | 438.25 g/mol |
| Exact Mass | 437.04 |
| IUPAC Name | N-(4-bromo-3-methylphenyl)-5-methyl-1-[3-(trifluoromethyl)phenyl]pyrazole-4-carboxamide |
| SMILES | Cc1cc(NC(=O)c2cnn(-c3cccc(C(F)(F)F)c3)c2C)ccc1Br |
| InChI | InChI=1S/C19H15BrF3N3O/c1-11-8-14(6-7-17(11)20)25-18(27)16-10-24-26(12(16)2)15-5-3-4-13(9-15)19(21,22)23/h3-10H,1-2H3,(H,25,27) |
| InChIKey | PCOXDKSGYZFGJJ-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.25 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |