C16H12F3N3O4S — CID 18271109
[1-(difluoromethyl)benzimidazol-2-yl]methyl 2-fluoro-5-sulfamoylbenzoate (PubChem CID 18271109) has the molecular formula C16H12F3N3O4S and a molecular weight of 399.35 g/mol. Its IUPAC name is [1-(difluoromethyl)benzimidazol-2-yl]methyl 2-fluoro-5-sulfamoylbenzoate.
| Compound Name | [1-(difluoromethyl)benzimidazol-2-yl]methyl 2-fluoro-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 18271109 |
| Molecular Formula | C16H12F3N3O4S |
| Molecular Weight | 399.35 g/mol |
| Exact Mass | 399.05 |
| IUPAC Name | [1-(difluoromethyl)benzimidazol-2-yl]methyl 2-fluoro-5-sulfamoylbenzoate |
| SMILES | NS(=O)(=O)c1ccc(F)c(C(=O)OCc2nc3ccccc3n2C(F)F)c1 |
| InChI | InChI=1S/C16H12F3N3O4S/c17-11-6-5-9(27(20,24)25)7-10(11)15(23)26-8-14-21-12-3-1-2-4-13(12)22(14)16(18)19/h1-7,16H,8H2,(H2,20,24,25) |
| InChIKey | VDJDITDYWXNDLG-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 104.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.35 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |