C16H17BrN4O4 — CID 18271743
4-bromo-N'-[2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetyl]benzohydrazide (PubChem CID 18271743) has the molecular formula C16H17BrN4O4 and a molecular weight of 409.24 g/mol. Its IUPAC name is 4-bromo-N'-[2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetyl]benzohydrazide.
| Compound Name | 4-bromo-N'-[2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetyl]benzohydrazide |
|---|---|
| PubChem CID | 18271743 |
| Molecular Formula | C16H17BrN4O4 |
| Molecular Weight | 409.24 g/mol |
| Exact Mass | 408.04 |
| IUPAC Name | 4-bromo-N'-[2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetyl]benzohydrazide |
| SMILES | O=C(CN1C(=O)NC2(CCCC2)C1=O)NNC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C16H17BrN4O4/c17-11-5-3-10(4-6-11)13(23)20-19-12(22)9-21-14(24)16(18-15(21)25)7-1-2-8-16/h3-6H,1-2,7-9H2,(H,18,25)(H,19,22)(H,20,23) |
| InChIKey | SSSGRWLNCUEZRF-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.24 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|