C20H19Cl2N3O3 — CID 18272166
3-[(E)-[5-(2,5-dichlorophenyl)furan-2-yl]methylideneamino]-8-methyl-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 18272166) has the molecular formula C20H19Cl2N3O3 and a molecular weight of 420.30 g/mol. Its IUPAC name is 3-[(E)-[5-(2,5-dichlorophenyl)furan-2-yl]methylideneamino]-8-methyl-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-[(E)-[5-(2,5-dichlorophenyl)furan-2-yl]methylideneamino]-8-methyl-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 18272166 |
| Molecular Formula | C20H19Cl2N3O3 |
| Molecular Weight | 420.30 g/mol |
| Exact Mass | 419.08 |
| IUPAC Name | 3-[(E)-[5-(2,5-dichlorophenyl)furan-2-yl]methylideneamino]-8-methyl-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | CC1CCC2(CC1)NC(=O)N(/N=C/c1ccc(-c3cc(Cl)ccc3Cl)o1)C2=O |
| InChI | InChI=1S/C20H19Cl2N3O3/c1-12-6-8-20(9-7-12)18(26)25(19(27)24-20)23-11-14-3-5-17(28-14)15-10-13(21)2-4-16(15)22/h2-5,10-12H,6-9H2,1H3,(H,24,27)/b23-11+ |
| InChIKey | NSSNCJQRJVZESJ-FOKLQQMPSA-N |
| XLogP | 5.09 |
| TPSA | 74.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.30 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|