C27H30N2O3 — CID 18273294
[1-(4-methylpiperidin-1-yl)-1-oxopropan-2-yl] 2-(2-methyl-4-phenylquinolin-3-yl)acetate (PubChem CID 18273294) has the molecular formula C27H30N2O3 and a molecular weight of 430.55 g/mol. Its IUPAC name is [1-(4-methylpiperidin-1-yl)-1-oxopropan-2-yl] 2-(2-methyl-4-phenylquinolin-3-yl)acetate.
| Compound Name | [1-(4-methylpiperidin-1-yl)-1-oxopropan-2-yl] 2-(2-methyl-4-phenylquinolin-3-yl)acetate |
|---|---|
| PubChem CID | 18273294 |
| Molecular Formula | C27H30N2O3 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.23 |
| IUPAC Name | [1-(4-methylpiperidin-1-yl)-1-oxopropan-2-yl] 2-(2-methyl-4-phenylquinolin-3-yl)acetate |
| SMILES | Cc1nc2ccccc2c(-c2ccccc2)c1CC(=O)OC(C)C(=O)N1CCC(C)CC1 |
| InChI | InChI=1S/C27H30N2O3/c1-18-13-15-29(16-14-18)27(31)20(3)32-25(30)17-23-19(2)28-24-12-8-7-11-22(24)26(23)21-9-5-4-6-10-21/h4-12,18,20H,13-17H2,1-3H3 |
| InChIKey | CJUOGFNNDGEUCN-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |