C24H28N2O3 — CID 18274433
1-(6,7-diethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-3-indol-1-ylpropan-1-one (PubChem CID 18274433) has the molecular formula C24H28N2O3 and a molecular weight of 392.50 g/mol. Its IUPAC name is 1-(6,7-diethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-3-indol-1-ylpropan-1-one.
| Compound Name | 1-(6,7-diethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-3-indol-1-ylpropan-1-one |
|---|---|
| PubChem CID | 18274433 |
| Molecular Formula | C24H28N2O3 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | 1-(6,7-diethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-3-indol-1-ylpropan-1-one |
| SMILES | CCOc1cc2c(cc1OCC)CN(C(=O)CCn1ccc3ccccc31)CC2 |
| InChI | InChI=1S/C24H28N2O3/c1-3-28-22-15-19-10-13-26(17-20(19)16-23(22)29-4-2)24(27)11-14-25-12-9-18-7-5-6-8-21(18)25/h5-9,12,15-16H,3-4,10-11,13-14,17H2,1-2H3 |
| InChIKey | RJNJJEDRBLTJMB-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 43.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |