About 2-(5-cyano-3-ethyl-2,6-dioxopyrimidin-1-yl)-N-(2-methoxyethyl)acetamide
2-(5-cyano-3-ethyl-2,6-dioxopyrimidin-1-yl)-N-(2-methoxyethyl)acetamide (PubChem CID 18274578) has the molecular formula C12H16N4O4
and a molecular weight of 280.28 g/mol. Its IUPAC name is 2-(5-cyano-3-ethyl-2,6-dioxopyrimidin-1-yl)-N-(2-methoxyethyl)acetamide.
Molecular Properties
| Compound Name | 2-(5-cyano-3-ethyl-2,6-dioxopyrimidin-1-yl)-N-(2-methoxyethyl)acetamide |
| PubChem CID | 18274578 |
| Molecular Formula | C12H16N4O4 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 2-(5-cyano-3-ethyl-2,6-dioxopyrimidin-1-yl)-N-(2-methoxyethyl)acetamide |
| SMILES | CCn1cc(C#N)c(=O)n(CC(=O)NCCOC)c1=O |
| InChI | InChI=1S/C12H16N4O4/c1-3-15-7-9(6-13)11(18)16(12(15)19)8-10(17)14-4-5-20-2/h7H,3-5,8H2,1-2H3,(H,14,17) |
| InChIKey | DXMDUVSGRIPFMR-UHFFFAOYSA-N |
| XLogP | -1.34 |
| TPSA | 106.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(5-cyano-3-ethyl-2,6-dioxopyrimidin-1-yl)-N-(2-methoxyethyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-cyano-3-ethyl-2,6-dioxopyrimidin-1-yl)-N-(2-methoxyethyl)acetamide?
The IUPAC name of 2-(5-cyano-3-ethyl-2,6-dioxopyrimidin-1-yl)-N-(2-methoxyethyl)acetamide (CID 18274578) is 2-(5-cyano-3-ethyl-2,6-dioxopyrimidin-1-yl)-N-(2-methoxyethyl)acetamide.
What is the SMILES notation for 2-(5-cyano-3-ethyl-2,6-dioxopyrimidin-1-yl)-N-(2-methoxyethyl)acetamide?
The canonical SMILES for 2-(5-cyano-3-ethyl-2,6-dioxopyrimidin-1-yl)-N-(2-methoxyethyl)acetamide is CCn1cc(C#N)c(=O)n(CC(=O)NCCOC)c1=O.
What is the InChIKey of 2-(5-cyano-3-ethyl-2,6-dioxopyrimidin-1-yl)-N-(2-methoxyethyl)acetamide?
The InChIKey is DXMDUVSGRIPFMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N4O4/c1-3-15-7-9(6-13)11(18)16(12(15)19)8-10(17)14-4-5-20-2/h7H,3-5,8H2,1-2H3,(H,14,17).
What are the key properties of 2-(5-cyano-3-ethyl-2,6-dioxopyrimidin-1-yl)-N-(2-methoxyethyl)acetamide?
2-(5-cyano-3-ethyl-2,6-dioxopyrimidin-1-yl)-N-(2-methoxyethyl)acetamide has a molecular weight of 280.28 g/mol, XLogP of -1.34, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-cyano-3-ethyl-2,6-dioxopyrimidin-1-yl)-N-(2-methoxyethyl)acetamide is sourced from PubChem (CID 18274578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).