C23H18N4OS — CID 18275467
6-[[5-[(E)-2-(5-methylfuran-2-yl)ethenyl]-1H-1,2,4-triazol-3-yl]sulfanylmethyl]phenanthridine (PubChem CID 18275467) has the molecular formula C23H18N4OS and a molecular weight of 398.49 g/mol. Its IUPAC name is 6-[[5-[(E)-2-(5-methylfuran-2-yl)ethenyl]-1H-1,2,4-triazol-3-yl]sulfanylmethyl]phenanthridine.
| Compound Name | 6-[[5-[(E)-2-(5-methylfuran-2-yl)ethenyl]-1H-1,2,4-triazol-3-yl]sulfanylmethyl]phenanthridine |
|---|---|
| PubChem CID | 18275467 |
| Molecular Formula | C23H18N4OS |
| Molecular Weight | 398.49 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | 6-[[5-[(E)-2-(5-methylfuran-2-yl)ethenyl]-1H-1,2,4-triazol-3-yl]sulfanylmethyl]phenanthridine |
| SMILES | Cc1ccc(/C=C/c2nc(SCc3nc4ccccc4c4ccccc34)n[nH]2)o1 |
| InChI | InChI=1S/C23H18N4OS/c1-15-10-11-16(28-15)12-13-22-25-23(27-26-22)29-14-21-19-8-3-2-6-17(19)18-7-4-5-9-20(18)24-21/h2-13H,14H2,1H3,(H,25,26,27)/b13-12+ |
| InChIKey | OWDCDXSRJDQNCQ-OUKQBFOZSA-N |
| XLogP | 5.87 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.49 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|