C21H23N5O5 — CID 18277135
N-[4-(2-oxopyrrolidin-1-yl)phenyl]-2-[2,4,6-trioxo-3,5-bis(prop-2-enyl)-1,3,5-triazinan-1-yl]acetamide (PubChem CID 18277135) has the molecular formula C21H23N5O5 and a molecular weight of 425.45 g/mol. Its IUPAC name is N-[4-(2-oxopyrrolidin-1-yl)phenyl]-2-[2,4,6-trioxo-3,5-bis(prop-2-enyl)-1,3,5-triazinan-1-yl]acetamide.
| Compound Name | N-[4-(2-oxopyrrolidin-1-yl)phenyl]-2-[2,4,6-trioxo-3,5-bis(prop-2-enyl)-1,3,5-triazinan-1-yl]acetamide |
|---|---|
| PubChem CID | 18277135 |
| Molecular Formula | C21H23N5O5 |
| Molecular Weight | 425.45 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | N-[4-(2-oxopyrrolidin-1-yl)phenyl]-2-[2,4,6-trioxo-3,5-bis(prop-2-enyl)-1,3,5-triazinan-1-yl]acetamide |
| SMILES | C=CCn1c(=O)n(CC=C)c(=O)n(CC(=O)Nc2ccc(N3CCCC3=O)cc2)c1=O |
| InChI | InChI=1S/C21H23N5O5/c1-3-11-24-19(29)25(12-4-2)21(31)26(20(24)30)14-17(27)22-15-7-9-16(10-8-15)23-13-5-6-18(23)28/h3-4,7-10H,1-2,5-6,11-14H2,(H,22,27) |
| InChIKey | OLCDMSIGZFHMMC-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 115.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.45 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|