About N-[(1,1-dioxothiolan-3-yl)carbamothioyl]cyclohexanecarboxamide
N-[(1,1-dioxothiolan-3-yl)carbamothioyl]cyclohexanecarboxamide (PubChem CID 18281578) has the molecular formula C12H20N2O3S2
and a molecular weight of 304.44 g/mol. Its IUPAC name is N-[(1,1-dioxothiolan-3-yl)carbamothioyl]cyclohexanecarboxamide.
Molecular Properties
| Compound Name | N-[(1,1-dioxothiolan-3-yl)carbamothioyl]cyclohexanecarboxamide |
| PubChem CID | 18281578 |
| Molecular Formula | C12H20N2O3S2 |
| Molecular Weight | 304.44 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | N-[(1,1-dioxothiolan-3-yl)carbamothioyl]cyclohexanecarboxamide |
| SMILES | O=C(NC(=S)NC1CCS(=O)(=O)C1)C1CCCCC1 |
| InChI | InChI=1S/C12H20N2O3S2/c15-11(9-4-2-1-3-5-9)14-12(18)13-10-6-7-19(16,17)8-10/h9-10H,1-8H2,(H2,13,14,15,18) |
| InChIKey | FFQAHLPBLNHMKN-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.44 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N-[(1,1-dioxothiolan-3-yl)carbamothioyl]cyclohexanecarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1,1-dioxothiolan-3-yl)carbamothioyl]cyclohexanecarboxamide?
The IUPAC name of N-[(1,1-dioxothiolan-3-yl)carbamothioyl]cyclohexanecarboxamide (CID 18281578) is N-[(1,1-dioxothiolan-3-yl)carbamothioyl]cyclohexanecarboxamide.
What is the SMILES notation for N-[(1,1-dioxothiolan-3-yl)carbamothioyl]cyclohexanecarboxamide?
The canonical SMILES for N-[(1,1-dioxothiolan-3-yl)carbamothioyl]cyclohexanecarboxamide is O=C(NC(=S)NC1CCS(=O)(=O)C1)C1CCCCC1.
What is the InChIKey of N-[(1,1-dioxothiolan-3-yl)carbamothioyl]cyclohexanecarboxamide?
The InChIKey is FFQAHLPBLNHMKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N2O3S2/c15-11(9-4-2-1-3-5-9)14-12(18)13-10-6-7-19(16,17)8-10/h9-10H,1-8H2,(H2,13,14,15,18).
What are the key properties of N-[(1,1-dioxothiolan-3-yl)carbamothioyl]cyclohexanecarboxamide?
N-[(1,1-dioxothiolan-3-yl)carbamothioyl]cyclohexanecarboxamide has a molecular weight of 304.44 g/mol, XLogP of 0.74, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1,1-dioxothiolan-3-yl)carbamothioyl]cyclohexanecarboxamide is sourced from PubChem (CID 18281578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).