C22H24N2O3S — CID 18282194
(2E,4E)-N-[4-methyl-3-(morpholine-4-carbonyl)-5-phenylthiophen-2-yl]hexa-2,4-dienamide (PubChem CID 18282194) has the molecular formula C22H24N2O3S and a molecular weight of 396.51 g/mol. Its IUPAC name is (2E,4E)-N-[4-methyl-3-(morpholine-4-carbonyl)-5-phenylthiophen-2-yl]hexa-2,4-dienamide.
| Compound Name | (2E,4E)-N-[4-methyl-3-(morpholine-4-carbonyl)-5-phenylthiophen-2-yl]hexa-2,4-dienamide |
|---|---|
| PubChem CID | 18282194 |
| Molecular Formula | C22H24N2O3S |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | (2E,4E)-N-[4-methyl-3-(morpholine-4-carbonyl)-5-phenylthiophen-2-yl]hexa-2,4-dienamide |
| SMILES | C/C=C/C=C/C(=O)Nc1sc(-c2ccccc2)c(C)c1C(=O)N1CCOCC1 |
| InChI | InChI=1S/C22H24N2O3S/c1-3-4-6-11-18(25)23-21-19(22(26)24-12-14-27-15-13-24)16(2)20(28-21)17-9-7-5-8-10-17/h3-11H,12-15H2,1-2H3,(H,23,25)/b4-3+,11-6+ |
| InChIKey | KTTOCWDGNVUNPE-HFBSYCRKSA-N |
| XLogP | 4.27 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|