C23H24FNO3 — CID 18282783
3-[5-(2-fluorophenyl)furan-2-yl]-N-[1-(2-methoxy-5-methylphenyl)ethyl]propanamide (PubChem CID 18282783) has the molecular formula C23H24FNO3 and a molecular weight of 381.45 g/mol. Its IUPAC name is 3-[5-(2-fluorophenyl)furan-2-yl]-N-[1-(2-methoxy-5-methylphenyl)ethyl]propanamide.
| Compound Name | 3-[5-(2-fluorophenyl)furan-2-yl]-N-[1-(2-methoxy-5-methylphenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 18282783 |
| Molecular Formula | C23H24FNO3 |
| Molecular Weight | 381.45 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | 3-[5-(2-fluorophenyl)furan-2-yl]-N-[1-(2-methoxy-5-methylphenyl)ethyl]propanamide |
| SMILES | COc1ccc(C)cc1C(C)NC(=O)CCc1ccc(-c2ccccc2F)o1 |
| InChI | InChI=1S/C23H24FNO3/c1-15-8-11-21(27-3)19(14-15)16(2)25-23(26)13-10-17-9-12-22(28-17)18-6-4-5-7-20(18)24/h4-9,11-12,14,16H,10,13H2,1-3H3,(H,25,26) |
| InChIKey | ZWXRTRZWDJUPPS-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.45 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |