About (Z)-N-(2,5-difluorophenyl)-3-(furan-2-yl)-2-(5-phenyltetrazol-1-yl)prop-2-enamide
(Z)-N-(2,5-difluorophenyl)-3-(furan-2-yl)-2-(5-phenyltetrazol-1-yl)prop-2-enamide (PubChem CID 18283418) has the molecular formula C20H13F2N5O2
and a molecular weight of 393.35 g/mol. Its IUPAC name is (Z)-N-(2,5-difluorophenyl)-3-(furan-2-yl)-2-(5-phenyltetrazol-1-yl)prop-2-enamide.
Molecular Properties
| Compound Name | (Z)-N-(2,5-difluorophenyl)-3-(furan-2-yl)-2-(5-phenyltetrazol-1-yl)prop-2-enamide |
| PubChem CID | 18283418 |
| Molecular Formula | C20H13F2N5O2 |
| Molecular Weight | 393.35 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | (Z)-N-(2,5-difluorophenyl)-3-(furan-2-yl)-2-(5-phenyltetrazol-1-yl)prop-2-enamide |
| SMILES | O=C(Nc1cc(F)ccc1F)/C(=C/c1ccco1)n1nnnc1-c1ccccc1 |
| InChI | InChI=1S/C20H13F2N5O2/c21-14-8-9-16(22)17(11-14)23-20(28)18(12-15-7-4-10-29-15)27-19(24-25-26-27)13-5-2-1-3-6-13/h1-12H,(H,23,28)/b18-12- |
| InChIKey | FELBSFQDLWGUOA-PDGQHHTCSA-N |
| XLogP | 3.85 |
| TPSA | 85.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.35 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-N-(2,5-difluorophenyl)-3-(furan-2-yl)-2-(5-phenyltetrazol-1-yl)prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N-(2,5-difluorophenyl)-3-(furan-2-yl)-2-(5-phenyltetrazol-1-yl)prop-2-enamide?
The IUPAC name of (Z)-N-(2,5-difluorophenyl)-3-(furan-2-yl)-2-(5-phenyltetrazol-1-yl)prop-2-enamide (CID 18283418) is (Z)-N-(2,5-difluorophenyl)-3-(furan-2-yl)-2-(5-phenyltetrazol-1-yl)prop-2-enamide.
What is the SMILES notation for (Z)-N-(2,5-difluorophenyl)-3-(furan-2-yl)-2-(5-phenyltetrazol-1-yl)prop-2-enamide?
The canonical SMILES for (Z)-N-(2,5-difluorophenyl)-3-(furan-2-yl)-2-(5-phenyltetrazol-1-yl)prop-2-enamide is O=C(Nc1cc(F)ccc1F)/C(=C/c1ccco1)n1nnnc1-c1ccccc1.
What is the InChIKey of (Z)-N-(2,5-difluorophenyl)-3-(furan-2-yl)-2-(5-phenyltetrazol-1-yl)prop-2-enamide?
The InChIKey is FELBSFQDLWGUOA-PDGQHHTCSA-N. The full InChI is InChI=1S/C20H13F2N5O2/c21-14-8-9-16(22)17(11-14)23-20(28)18(12-15-7-4-10-29-15)27-19(24-25-26-27)13-5-2-1-3-6-13/h1-12H,(H,23,28)/b18-12-.
What are the key properties of (Z)-N-(2,5-difluorophenyl)-3-(furan-2-yl)-2-(5-phenyltetrazol-1-yl)prop-2-enamide?
(Z)-N-(2,5-difluorophenyl)-3-(furan-2-yl)-2-(5-phenyltetrazol-1-yl)prop-2-enamide has a molecular weight of 393.35 g/mol, XLogP of 3.85, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N-(2,5-difluorophenyl)-3-(furan-2-yl)-2-(5-phenyltetrazol-1-yl)prop-2-enamide is sourced from PubChem (CID 18283418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).