C22H29N3O2S — CID 18283905
5-(2,2-dimethylpropanoylamino)-3-methyl-N-(4-piperidin-1-ylphenyl)thiophene-2-carboxamide (PubChem CID 18283905) has the molecular formula C22H29N3O2S and a molecular weight of 399.56 g/mol. Its IUPAC name is 5-(2,2-dimethylpropanoylamino)-3-methyl-N-(4-piperidin-1-ylphenyl)thiophene-2-carboxamide.
| Compound Name | 5-(2,2-dimethylpropanoylamino)-3-methyl-N-(4-piperidin-1-ylphenyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 18283905 |
| Molecular Formula | C22H29N3O2S |
| Molecular Weight | 399.56 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | 5-(2,2-dimethylpropanoylamino)-3-methyl-N-(4-piperidin-1-ylphenyl)thiophene-2-carboxamide |
| SMILES | Cc1cc(NC(=O)C(C)(C)C)sc1C(=O)Nc1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C22H29N3O2S/c1-15-14-18(24-21(27)22(2,3)4)28-19(15)20(26)23-16-8-10-17(11-9-16)25-12-6-5-7-13-25/h8-11,14H,5-7,12-13H2,1-4H3,(H,23,26)(H,24,27) |
| InChIKey | SSDFCANDORUKSJ-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.56 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|