C21H21FO5 — CID 18287145
[1-(4-fluorophenyl)-1-oxopropan-2-yl] (E)-3-(4-ethoxy-3-methoxyphenyl)prop-2-enoate (PubChem CID 18287145) has the molecular formula C21H21FO5 and a molecular weight of 372.39 g/mol. Its IUPAC name is [1-(4-fluorophenyl)-1-oxopropan-2-yl] (E)-3-(4-ethoxy-3-methoxyphenyl)prop-2-enoate.
| Compound Name | [1-(4-fluorophenyl)-1-oxopropan-2-yl] (E)-3-(4-ethoxy-3-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 18287145 |
| Molecular Formula | C21H21FO5 |
| Molecular Weight | 372.39 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | [1-(4-fluorophenyl)-1-oxopropan-2-yl] (E)-3-(4-ethoxy-3-methoxyphenyl)prop-2-enoate |
| SMILES | CCOc1ccc(/C=C/C(=O)OC(C)C(=O)c2ccc(F)cc2)cc1OC |
| InChI | InChI=1S/C21H21FO5/c1-4-26-18-11-5-15(13-19(18)25-3)6-12-20(23)27-14(2)21(24)16-7-9-17(22)10-8-16/h5-14H,4H2,1-3H3/b12-6+ |
| InChIKey | JUCSLMLWOZYRFA-WUXMJOGZSA-N |
| XLogP | 4.06 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.39 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|