C22H24N2O3S — CID 18287605
3-(1,3-benzodioxol-5-yl)-1-[4-ethyl-2-(3-methylphenyl)imino-1,3-thiazolidin-3-yl]propan-1-one (PubChem CID 18287605) has the molecular formula C22H24N2O3S and a molecular weight of 396.51 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-1-[4-ethyl-2-(3-methylphenyl)imino-1,3-thiazolidin-3-yl]propan-1-one.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-1-[4-ethyl-2-(3-methylphenyl)imino-1,3-thiazolidin-3-yl]propan-1-one |
|---|---|
| PubChem CID | 18287605 |
| Molecular Formula | C22H24N2O3S |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-1-[4-ethyl-2-(3-methylphenyl)imino-1,3-thiazolidin-3-yl]propan-1-one |
| SMILES | CCC1CS/C(=N\c2cccc(C)c2)N1C(=O)CCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C22H24N2O3S/c1-3-18-13-28-22(23-17-6-4-5-15(2)11-17)24(18)21(25)10-8-16-7-9-19-20(12-16)27-14-26-19/h4-7,9,11-12,18H,3,8,10,13-14H2,1-2H3/b23-22- |
| InChIKey | GNNUXTZLSTYBGD-FCQUAONHSA-N |
| XLogP | 4.70 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|