C18H30N2O5S2 — CID 18287855
N-(6-methylheptan-2-yl)-4-morpholin-4-ylsulfonylbenzenesulfonamide (PubChem CID 18287855) has the molecular formula C18H30N2O5S2 and a molecular weight of 418.58 g/mol. Its IUPAC name is N-(6-methylheptan-2-yl)-4-morpholin-4-ylsulfonylbenzenesulfonamide.
| Compound Name | N-(6-methylheptan-2-yl)-4-morpholin-4-ylsulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 18287855 |
| Molecular Formula | C18H30N2O5S2 |
| Molecular Weight | 418.58 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | N-(6-methylheptan-2-yl)-4-morpholin-4-ylsulfonylbenzenesulfonamide |
| SMILES | CC(C)CCCC(C)NS(=O)(=O)c1ccc(S(=O)(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C18H30N2O5S2/c1-15(2)5-4-6-16(3)19-26(21,22)17-7-9-18(10-8-17)27(23,24)20-11-13-25-14-12-20/h7-10,15-16,19H,4-6,11-14H2,1-3H3 |
| InChIKey | QLTDASCMPHGLCQ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.58 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |