C20H13ClFN3O2S — CID 18288671
N-(3-chloro-4-fluorophenyl)-2-(1-oxo-4-thiophen-2-ylphthalazin-2-yl)acetamide (PubChem CID 18288671) has the molecular formula C20H13ClFN3O2S and a molecular weight of 413.86 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-2-(1-oxo-4-thiophen-2-ylphthalazin-2-yl)acetamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-2-(1-oxo-4-thiophen-2-ylphthalazin-2-yl)acetamide |
|---|---|
| PubChem CID | 18288671 |
| Molecular Formula | C20H13ClFN3O2S |
| Molecular Weight | 413.86 g/mol |
| Exact Mass | 413.04 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-2-(1-oxo-4-thiophen-2-ylphthalazin-2-yl)acetamide |
| SMILES | O=C(Cn1nc(-c2cccs2)c2ccccc2c1=O)Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C20H13ClFN3O2S/c21-15-10-12(7-8-16(15)22)23-18(26)11-25-20(27)14-5-2-1-4-13(14)19(24-25)17-6-3-9-28-17/h1-10H,11H2,(H,23,26) |
| InChIKey | PKLIDIQWABNORD-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.86 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |