C21H20BrNO3 — CID 18288696
5-bromo-N-cyclopropyl-N-[(4-methoxyphenyl)methyl]-3-methyl-1-benzofuran-2-carboxamide (PubChem CID 18288696) has the molecular formula C21H20BrNO3 and a molecular weight of 414.30 g/mol. Its IUPAC name is 5-bromo-N-cyclopropyl-N-[(4-methoxyphenyl)methyl]-3-methyl-1-benzofuran-2-carboxamide.
| Compound Name | 5-bromo-N-cyclopropyl-N-[(4-methoxyphenyl)methyl]-3-methyl-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 18288696 |
| Molecular Formula | C21H20BrNO3 |
| Molecular Weight | 414.30 g/mol |
| Exact Mass | 413.06 |
| IUPAC Name | 5-bromo-N-cyclopropyl-N-[(4-methoxyphenyl)methyl]-3-methyl-1-benzofuran-2-carboxamide |
| SMILES | COc1ccc(CN(C(=O)c2oc3ccc(Br)cc3c2C)C2CC2)cc1 |
| InChI | InChI=1S/C21H20BrNO3/c1-13-18-11-15(22)5-10-19(18)26-20(13)21(24)23(16-6-7-16)12-14-3-8-17(25-2)9-4-14/h3-5,8-11,16H,6-7,12H2,1-2H3 |
| InChIKey | WFNJLMAWRMWDCN-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.30 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |