C24H21ClN2O3 — CID 18288988
N-[4-(2-chlorophenoxy)phenyl]-4-(2-oxopiperidin-1-yl)benzamide (PubChem CID 18288988) has the molecular formula C24H21ClN2O3 and a molecular weight of 420.90 g/mol. Its IUPAC name is N-[4-(2-chlorophenoxy)phenyl]-4-(2-oxopiperidin-1-yl)benzamide.
| Compound Name | N-[4-(2-chlorophenoxy)phenyl]-4-(2-oxopiperidin-1-yl)benzamide |
|---|---|
| PubChem CID | 18288988 |
| Molecular Formula | C24H21ClN2O3 |
| Molecular Weight | 420.90 g/mol |
| Exact Mass | 420.12 |
| IUPAC Name | N-[4-(2-chlorophenoxy)phenyl]-4-(2-oxopiperidin-1-yl)benzamide |
| SMILES | O=C(Nc1ccc(Oc2ccccc2Cl)cc1)c1ccc(N2CCCCC2=O)cc1 |
| InChI | InChI=1S/C24H21ClN2O3/c25-21-5-1-2-6-22(21)30-20-14-10-18(11-15-20)26-24(29)17-8-12-19(13-9-17)27-16-4-3-7-23(27)28/h1-2,5-6,8-15H,3-4,7,16H2,(H,26,29) |
| InChIKey | GXIOOXZRFYRPLW-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.90 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |