About propan-2-yl 4-[[1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carbonyl]amino]benzoate
propan-2-yl 4-[[1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carbonyl]amino]benzoate (PubChem CID 18289145) has the molecular formula C23H23FN2O3
and a molecular weight of 394.45 g/mol. Its IUPAC name is propan-2-yl 4-[[1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carbonyl]amino]benzoate.
Molecular Properties
| Compound Name | propan-2-yl 4-[[1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carbonyl]amino]benzoate |
| PubChem CID | 18289145 |
| Molecular Formula | C23H23FN2O3 |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | propan-2-yl 4-[[1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carbonyl]amino]benzoate |
| SMILES | Cc1cc(C(=O)Nc2ccc(C(=O)OC(C)C)cc2)c(C)n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C23H23FN2O3/c1-14(2)29-23(28)17-5-9-19(10-6-17)25-22(27)21-13-15(3)26(16(21)4)20-11-7-18(24)8-12-20/h5-14H,1-4H3,(H,25,27) |
| InChIKey | MCNHJAHGBCIEED-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|
Analyze propan-2-yl 4-[[1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carbonyl]amino]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 4-[[1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carbonyl]amino]benzoate?
The IUPAC name of propan-2-yl 4-[[1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carbonyl]amino]benzoate (CID 18289145) is propan-2-yl 4-[[1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carbonyl]amino]benzoate.
What is the SMILES notation for propan-2-yl 4-[[1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carbonyl]amino]benzoate?
The canonical SMILES for propan-2-yl 4-[[1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carbonyl]amino]benzoate is Cc1cc(C(=O)Nc2ccc(C(=O)OC(C)C)cc2)c(C)n1-c1ccc(F)cc1.
What is the InChIKey of propan-2-yl 4-[[1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carbonyl]amino]benzoate?
The InChIKey is MCNHJAHGBCIEED-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H23FN2O3/c1-14(2)29-23(28)17-5-9-19(10-6-17)25-22(27)21-13-15(3)26(16(21)4)20-11-7-18(24)8-12-20/h5-14H,1-4H3,(H,25,27).
What are the key properties of propan-2-yl 4-[[1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carbonyl]amino]benzoate?
propan-2-yl 4-[[1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carbonyl]amino]benzoate has a molecular weight of 394.45 g/mol, XLogP of 5.05, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 4-[[1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carbonyl]amino]benzoate is sourced from PubChem (CID 18289145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).