C17H11NO4 — CID 18289286
(3-cyanophenyl) 1-oxo-3,4-dihydroisochromene-3-carboxylate (PubChem CID 18289286) has the molecular formula C17H11NO4 and a molecular weight of 293.28 g/mol. Its IUPAC name is (3-cyanophenyl) 1-oxo-3,4-dihydroisochromene-3-carboxylate.
| Compound Name | (3-cyanophenyl) 1-oxo-3,4-dihydroisochromene-3-carboxylate |
|---|---|
| PubChem CID | 18289286 |
| Molecular Formula | C17H11NO4 |
| Molecular Weight | 293.28 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | (3-cyanophenyl) 1-oxo-3,4-dihydroisochromene-3-carboxylate |
| SMILES | N#Cc1cccc(OC(=O)C2Cc3ccccc3C(=O)O2)c1 |
| InChI | InChI=1S/C17H11NO4/c18-10-11-4-3-6-13(8-11)21-17(20)15-9-12-5-1-2-7-14(12)16(19)22-15/h1-8,15H,9H2 |
| InChIKey | VDTZVTBQAXTNOF-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.28 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|