C20H19N3O5 — CID 18290113
1-[(7-methyl-2-oxochromen-4-yl)methyl]-3,5-bis(prop-2-enyl)-1,3,5-triazinane-2,4,6-trione (PubChem CID 18290113) has the molecular formula C20H19N3O5 and a molecular weight of 381.39 g/mol. Its IUPAC name is 1-[(7-methyl-2-oxochromen-4-yl)methyl]-3,5-bis(prop-2-enyl)-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1-[(7-methyl-2-oxochromen-4-yl)methyl]-3,5-bis(prop-2-enyl)-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 18290113 |
| Molecular Formula | C20H19N3O5 |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | 1-[(7-methyl-2-oxochromen-4-yl)methyl]-3,5-bis(prop-2-enyl)-1,3,5-triazinane-2,4,6-trione |
| SMILES | C=CCn1c(=O)n(CC=C)c(=O)n(Cc2cc(=O)oc3cc(C)ccc23)c1=O |
| InChI | InChI=1S/C20H19N3O5/c1-4-8-21-18(25)22(9-5-2)20(27)23(19(21)26)12-14-11-17(24)28-16-10-13(3)6-7-15(14)16/h4-7,10-11H,1-2,8-9,12H2,3H3 |
| InChIKey | FBMVRELLAQOTNE-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 96.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|