C26H32FN3O2 — CID 18291811
(3E)-1-[4-[(3-fluoro-4-methoxyphenyl)methyl]piperazin-1-yl]-3-(1,3,3-trimethylindol-2-ylidene)propan-2-one (PubChem CID 18291811) has the molecular formula C26H32FN3O2 and a molecular weight of 437.56 g/mol. Its IUPAC name is (3E)-1-[4-[(3-fluoro-4-methoxyphenyl)methyl]piperazin-1-yl]-3-(1,3,3-trimethylindol-2-ylidene)propan-2-one.
| Compound Name | (3E)-1-[4-[(3-fluoro-4-methoxyphenyl)methyl]piperazin-1-yl]-3-(1,3,3-trimethylindol-2-ylidene)propan-2-one |
|---|---|
| PubChem CID | 18291811 |
| Molecular Formula | C26H32FN3O2 |
| Molecular Weight | 437.56 g/mol |
| Exact Mass | 437.25 |
| IUPAC Name | (3E)-1-[4-[(3-fluoro-4-methoxyphenyl)methyl]piperazin-1-yl]-3-(1,3,3-trimethylindol-2-ylidene)propan-2-one |
| SMILES | COc1ccc(CN2CCN(CC(=O)/C=C3/N(C)c4ccccc4C3(C)C)CC2)cc1F |
| InChI | InChI=1S/C26H32FN3O2/c1-26(2)21-7-5-6-8-23(21)28(3)25(26)16-20(31)18-30-13-11-29(12-14-30)17-19-9-10-24(32-4)22(27)15-19/h5-10,15-16H,11-14,17-18H2,1-4H3/b25-16+ |
| InChIKey | MMCAEQVKTXQVDQ-PCLIKHOPSA-N |
| XLogP | 3.83 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.56 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|