C25H22N2O3S — CID 18292230
3-(3-methoxyphenyl)-2-[1-(4-methylphenyl)-1-oxopropan-2-yl]sulfanylquinazolin-4-one (PubChem CID 18292230) has the molecular formula C25H22N2O3S and a molecular weight of 430.53 g/mol. Its IUPAC name is 3-(3-methoxyphenyl)-2-[1-(4-methylphenyl)-1-oxopropan-2-yl]sulfanylquinazolin-4-one.
| Compound Name | 3-(3-methoxyphenyl)-2-[1-(4-methylphenyl)-1-oxopropan-2-yl]sulfanylquinazolin-4-one |
|---|---|
| PubChem CID | 18292230 |
| Molecular Formula | C25H22N2O3S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | 3-(3-methoxyphenyl)-2-[1-(4-methylphenyl)-1-oxopropan-2-yl]sulfanylquinazolin-4-one |
| SMILES | COc1cccc(-n2c(SC(C)C(=O)c3ccc(C)cc3)nc3ccccc3c2=O)c1 |
| InChI | InChI=1S/C25H22N2O3S/c1-16-11-13-18(14-12-16)23(28)17(2)31-25-26-22-10-5-4-9-21(22)24(29)27(25)19-7-6-8-20(15-19)30-3/h4-15,17H,1-3H3 |
| InChIKey | BNNPMWYHRBJPNK-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |