C24H27N3O4 — CID 18292461
(E)-N-[(3,5-dimethoxyphenyl)-(1-methylimidazol-2-yl)methyl]-3-(4-ethoxyphenyl)prop-2-enamide (PubChem CID 18292461) has the molecular formula C24H27N3O4 and a molecular weight of 421.50 g/mol. Its IUPAC name is (E)-N-[(3,5-dimethoxyphenyl)-(1-methylimidazol-2-yl)methyl]-3-(4-ethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[(3,5-dimethoxyphenyl)-(1-methylimidazol-2-yl)methyl]-3-(4-ethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 18292461 |
| Molecular Formula | C24H27N3O4 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | (E)-N-[(3,5-dimethoxyphenyl)-(1-methylimidazol-2-yl)methyl]-3-(4-ethoxyphenyl)prop-2-enamide |
| SMILES | CCOc1ccc(/C=C/C(=O)NC(c2cc(OC)cc(OC)c2)c2nccn2C)cc1 |
| InChI | InChI=1S/C24H27N3O4/c1-5-31-19-9-6-17(7-10-19)8-11-22(28)26-23(24-25-12-13-27(24)2)18-14-20(29-3)16-21(15-18)30-4/h6-16,23H,5H2,1-4H3,(H,26,28)/b11-8+ |
| InChIKey | MUXACUQTJQTKGA-DHZHZOJOSA-N |
| XLogP | 3.76 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|