C24H22ClN3O3 — CID 18292701
4-chloro-N-[4-(4-methoxyanilino)phenyl]-3-(2-oxopyrrolidin-1-yl)benzamide (PubChem CID 18292701) has the molecular formula C24H22ClN3O3 and a molecular weight of 435.91 g/mol. Its IUPAC name is 4-chloro-N-[4-(4-methoxyanilino)phenyl]-3-(2-oxopyrrolidin-1-yl)benzamide.
| Compound Name | 4-chloro-N-[4-(4-methoxyanilino)phenyl]-3-(2-oxopyrrolidin-1-yl)benzamide |
|---|---|
| PubChem CID | 18292701 |
| Molecular Formula | C24H22ClN3O3 |
| Molecular Weight | 435.91 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | 4-chloro-N-[4-(4-methoxyanilino)phenyl]-3-(2-oxopyrrolidin-1-yl)benzamide |
| SMILES | COc1ccc(Nc2ccc(NC(=O)c3ccc(Cl)c(N4CCCC4=O)c3)cc2)cc1 |
| InChI | InChI=1S/C24H22ClN3O3/c1-31-20-11-9-18(10-12-20)26-17-5-7-19(8-6-17)27-24(30)16-4-13-21(25)22(15-16)28-14-2-3-23(28)29/h4-13,15,26H,2-3,14H2,1H3,(H,27,30) |
| InChIKey | UNCZXKGAHYHJSO-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.91 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |