C25H36N6O7 — CID 18297853
2-[[4-amino-2-[[2-[(2-amino-3-methylpentanoyl)amino]-3-hydroxybutanoyl]amino]-4-oxobutanoyl]amino]-3-(1H-indol-3-yl)propanoic acid (PubChem CID 18297853) has the molecular formula C25H36N6O7 and a molecular weight of 532.60 g/mol. Its IUPAC name is 2-[[4-amino-2-[[2-[(2-amino-3-methylpentanoyl)amino]-3-hydroxybutanoyl]amino]-4-oxobutanoyl]amino]-3-(1H-indol-3-yl)propanoic acid.
| Compound Name | 2-[[4-amino-2-[[2-[(2-amino-3-methylpentanoyl)amino]-3-hydroxybutanoyl]amino]-4-oxobutanoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 18297853 |
| Molecular Formula | C25H36N6O7 |
| Molecular Weight | 532.60 g/mol |
| Exact Mass | 532.26 |
| IUPAC Name | 2-[[4-amino-2-[[2-[(2-amino-3-methylpentanoyl)amino]-3-hydroxybutanoyl]amino]-4-oxobutanoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
| SMILES | CCC(C)C(N)C(=O)NC(C(=O)NC(CC(N)=O)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)O)C(C)O |
| InChI | InChI=1S/C25H36N6O7/c1-4-12(2)20(27)23(35)31-21(13(3)32)24(36)29-17(10-19(26)33)22(34)30-18(25(37)38)9-14-11-28-16-8-6-5-7-15(14)16/h5-8,11-13,17-18,20-21,28,32H,4,9-10,27H2,1-3H3,(H2,26,33)(H,29,36)(H,30,34)(H,31,35)(H,37,38) |
| InChIKey | FXNPRCQRJLSHKG-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 229.73 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.60 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |