About benzo[b]pyrene-6,12-dione
benzo[b]pyrene-6,12-dione (PubChem CID 18299) has the molecular formula C20H10O2
and a molecular weight of 282.30 g/mol. Its IUPAC name is benzo[b]pyrene-6,12-dione.
Molecular Properties
| Compound Name | benzo[b]pyrene-6,12-dione |
| PubChem CID | 18299 |
| Molecular Formula | C20H10O2 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | benzo[b]pyrene-6,12-dione |
| SMILES | O=c1c2ccc3cccc4c(=O)cc(c5ccccc15)-c2c34 |
| InChI | InChI=1S/C20H10O2/c21-17-10-16-12-5-1-2-6-13(12)20(22)15-9-8-11-4-3-7-14(17)18(11)19(15)16/h1-10H |
| InChIKey | HSJQJGAVYCLWJA-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze benzo[b]pyrene-6,12-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzo[b]pyrene-6,12-dione?
The IUPAC name of benzo[b]pyrene-6,12-dione (CID 18299) is benzo[b]pyrene-6,12-dione.
What is the SMILES notation for benzo[b]pyrene-6,12-dione?
The canonical SMILES for benzo[b]pyrene-6,12-dione is O=c1c2ccc3cccc4c(=O)cc(c5ccccc15)-c2c34.
What is the InChIKey of benzo[b]pyrene-6,12-dione?
The InChIKey is HSJQJGAVYCLWJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H10O2/c21-17-10-16-12-5-1-2-6-13(12)20(22)15-9-8-11-4-3-7-14(17)18(11)19(15)16/h1-10H.
What are the key properties of benzo[b]pyrene-6,12-dione?
benzo[b]pyrene-6,12-dione has a molecular weight of 282.30 g/mol, XLogP of 3.85, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzo[b]pyrene-6,12-dione is sourced from PubChem (CID 18299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).