C18H34N6O6S — CID 18307090
2-[[4-amino-2-[[2-(2,6-diaminohexanoylamino)-4-methylsulfanylbutanoyl]amino]-4-oxobutanoyl]amino]propanoic acid (PubChem CID 18307090) has the molecular formula C18H34N6O6S and a molecular weight of 462.57 g/mol. Its IUPAC name is 2-[[4-amino-2-[[2-(2,6-diaminohexanoylamino)-4-methylsulfanylbutanoyl]amino]-4-oxobutanoyl]amino]propanoic acid.
| Compound Name | 2-[[4-amino-2-[[2-(2,6-diaminohexanoylamino)-4-methylsulfanylbutanoyl]amino]-4-oxobutanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 18307090 |
| Molecular Formula | C18H34N6O6S |
| Molecular Weight | 462.57 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | 2-[[4-amino-2-[[2-(2,6-diaminohexanoylamino)-4-methylsulfanylbutanoyl]amino]-4-oxobutanoyl]amino]propanoic acid |
| SMILES | CSCCC(NC(=O)C(N)CCCCN)C(=O)NC(CC(N)=O)C(=O)NC(C)C(=O)O |
| InChI | InChI=1S/C18H34N6O6S/c1-10(18(29)30)22-17(28)13(9-14(21)25)24-16(27)12(6-8-31-2)23-15(26)11(20)5-3-4-7-19/h10-13H,3-9,19-20H2,1-2H3,(H2,21,25)(H,22,28)(H,23,26)(H,24,27)(H,29,30) |
| InChIKey | QHFKOYCYYFPACO-UHFFFAOYSA-N |
| XLogP | -2.37 |
| TPSA | 219.73 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.57 |
| LogP ≤ 5 | -2.37 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|