C20H33N7O5 — CID 18307857
2-[2-[[1-(2,6-diaminohexanoyl)pyrrolidine-2-carbonyl]amino]propanoylamino]-3-(1H-imidazol-5-yl)propanoic acid (PubChem CID 18307857) has the molecular formula C20H33N7O5 and a molecular weight of 451.53 g/mol. Its IUPAC name is 2-[2-[[1-(2,6-diaminohexanoyl)pyrrolidine-2-carbonyl]amino]propanoylamino]-3-(1H-imidazol-5-yl)propanoic acid.
| Compound Name | 2-[2-[[1-(2,6-diaminohexanoyl)pyrrolidine-2-carbonyl]amino]propanoylamino]-3-(1H-imidazol-5-yl)propanoic acid |
|---|---|
| PubChem CID | 18307857 |
| Molecular Formula | C20H33N7O5 |
| Molecular Weight | 451.53 g/mol |
| Exact Mass | 451.25 |
| IUPAC Name | 2-[2-[[1-(2,6-diaminohexanoyl)pyrrolidine-2-carbonyl]amino]propanoylamino]-3-(1H-imidazol-5-yl)propanoic acid |
| SMILES | CC(NC(=O)C1CCCN1C(=O)C(N)CCCCN)C(=O)NC(Cc1cnc[nH]1)C(=O)O |
| InChI | InChI=1S/C20H33N7O5/c1-12(17(28)26-15(20(31)32)9-13-10-23-11-24-13)25-18(29)16-6-4-8-27(16)19(30)14(22)5-2-3-7-21/h10-12,14-16H,2-9,21-22H2,1H3,(H,23,24)(H,25,29)(H,26,28)(H,31,32) |
| InChIKey | MOCKCTUZTYKVJQ-UHFFFAOYSA-N |
| XLogP | -1.53 |
| TPSA | 196.53 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.53 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|