C25H24Cl2N2O2 — CID 18313478
[(1S,7S)-1,10,10-trimethyl-3-phenyl-3,4-diazatricyclo[5.2.1.02,6]deca-2(6),4-dien-5-yl]methyl 2,4-dichlorobenzoate (PubChem CID 18313478) has the molecular formula C25H24Cl2N2O2 and a molecular weight of 455.39 g/mol. Its IUPAC name is [(1S,7S)-1,10,10-trimethyl-3-phenyl-3,4-diazatricyclo[5.2.1.02,6]deca-2(6),4-dien-5-yl]methyl 2,4-dichlorobenzoate.
| Compound Name | [(1S,7S)-1,10,10-trimethyl-3-phenyl-3,4-diazatricyclo[5.2.1.02,6]deca-2(6),4-dien-5-yl]methyl 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 18313478 |
| Molecular Formula | C25H24Cl2N2O2 |
| Molecular Weight | 455.39 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | [(1S,7S)-1,10,10-trimethyl-3-phenyl-3,4-diazatricyclo[5.2.1.02,6]deca-2(6),4-dien-5-yl]methyl 2,4-dichlorobenzoate |
| SMILES | CC1(C)[C@@H]2CC[C@]1(C)c1c2c(COC(=O)c2ccc(Cl)cc2Cl)nn1-c1ccccc1 |
| InChI | InChI=1S/C25H24Cl2N2O2/c1-24(2)18-11-12-25(24,3)22-21(18)20(28-29(22)16-7-5-4-6-8-16)14-31-23(30)17-10-9-15(26)13-19(17)27/h4-10,13,18H,11-12,14H2,1-3H3/t18-,25-/m1/s1 |
| InChIKey | FLIFACHELHHAOV-IQGLISFBSA-N |
| XLogP | 6.71 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.39 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |