C13H17N3O2S — CID 18313500
(1S,5S)-1,8,8-trimethyl-3-(5-methyl-1,3,4-thiadiazol-2-yl)-3-azabicyclo[3.2.1]octane-2,4-dione (PubChem CID 18313500) has the molecular formula C13H17N3O2S and a molecular weight of 279.37 g/mol. Its IUPAC name is (1S,5S)-1,8,8-trimethyl-3-(5-methyl-1,3,4-thiadiazol-2-yl)-3-azabicyclo[3.2.1]octane-2,4-dione.
| Compound Name | (1S,5S)-1,8,8-trimethyl-3-(5-methyl-1,3,4-thiadiazol-2-yl)-3-azabicyclo[3.2.1]octane-2,4-dione |
|---|---|
| PubChem CID | 18313500 |
| Molecular Formula | C13H17N3O2S |
| Molecular Weight | 279.37 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | (1S,5S)-1,8,8-trimethyl-3-(5-methyl-1,3,4-thiadiazol-2-yl)-3-azabicyclo[3.2.1]octane-2,4-dione |
| SMILES | Cc1nnc(N2C(=O)[C@H]3CC[C@](C)(C2=O)C3(C)C)s1 |
| InChI | InChI=1S/C13H17N3O2S/c1-7-14-15-11(19-7)16-9(17)8-5-6-13(4,10(16)18)12(8,2)3/h8H,5-6H2,1-4H3/t8-,13-/m1/s1 |
| InChIKey | CSFDVKRUGIVTFT-AMIZOPFISA-N |
| XLogP | 2.16 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.37 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|