About ethanol;1-methylpyrrolidin-2-one
ethanol;1-methylpyrrolidin-2-one (PubChem CID 18313719) has the molecular formula C7H15NO2
and a molecular weight of 145.20 g/mol. Its IUPAC name is ethanol;1-methylpyrrolidin-2-one.
Molecular Properties
| Compound Name | ethanol;1-methylpyrrolidin-2-one |
| PubChem CID | 18313719 |
| Molecular Formula | C7H15NO2 |
| Molecular Weight | 145.20 g/mol |
| Exact Mass | 145.11 |
| IUPAC Name | ethanol;1-methylpyrrolidin-2-one |
| SMILES | CCO.CN1CCCC1=O |
| InChI | InChI=1S/C5H9NO.C2H6O/c1-6-4-2-3-5(6)7;1-2-3/h2-4H2,1H3;3H,2H2,1H3 |
| InChIKey | CRWIOTZGUJAUOZ-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.20 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethanol;1-methylpyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanol;1-methylpyrrolidin-2-one?
The IUPAC name of ethanol;1-methylpyrrolidin-2-one (CID 18313719) is ethanol;1-methylpyrrolidin-2-one.
What is the SMILES notation for ethanol;1-methylpyrrolidin-2-one?
The canonical SMILES for ethanol;1-methylpyrrolidin-2-one is CCO.CN1CCCC1=O.
What is the InChIKey of ethanol;1-methylpyrrolidin-2-one?
The InChIKey is CRWIOTZGUJAUOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO.C2H6O/c1-6-4-2-3-5(6)7;1-2-3/h2-4H2,1H3;3H,2H2,1H3.
What are the key properties of ethanol;1-methylpyrrolidin-2-one?
ethanol;1-methylpyrrolidin-2-one has a molecular weight of 145.20 g/mol, XLogP of 0.24, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethanol;1-methylpyrrolidin-2-one is sourced from PubChem (CID 18313719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).