About 2-methyl-N,N-bis(2-methylpropyl)propan-1-amine;hydrochloride
2-methyl-N,N-bis(2-methylpropyl)propan-1-amine;hydrochloride (PubChem CID 18314135) has the molecular formula C12H28ClN
and a molecular weight of 221.82 g/mol. Its IUPAC name is 2-methyl-N,N-bis(2-methylpropyl)propan-1-amine;hydrochloride.
Molecular Properties
| Compound Name | 2-methyl-N,N-bis(2-methylpropyl)propan-1-amine;hydrochloride |
| PubChem CID | 18314135 |
| Molecular Formula | C12H28ClN |
| Molecular Weight | 221.82 g/mol |
| Exact Mass | 221.19 |
| IUPAC Name | 2-methyl-N,N-bis(2-methylpropyl)propan-1-amine;hydrochloride |
| SMILES | CC(C)CN(CC(C)C)CC(C)C.Cl |
| InChI | InChI=1S/C12H27N.ClH/c1-10(2)7-13(8-11(3)4)9-12(5)6;/h10-12H,7-9H2,1-6H3;1H |
| InChIKey | JHBBVSNPCAYYIA-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.82 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-methyl-N,N-bis(2-methylpropyl)propan-1-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-N,N-bis(2-methylpropyl)propan-1-amine;hydrochloride?
The IUPAC name of 2-methyl-N,N-bis(2-methylpropyl)propan-1-amine;hydrochloride (CID 18314135) is 2-methyl-N,N-bis(2-methylpropyl)propan-1-amine;hydrochloride.
What is the SMILES notation for 2-methyl-N,N-bis(2-methylpropyl)propan-1-amine;hydrochloride?
The canonical SMILES for 2-methyl-N,N-bis(2-methylpropyl)propan-1-amine;hydrochloride is CC(C)CN(CC(C)C)CC(C)C.Cl.
What is the InChIKey of 2-methyl-N,N-bis(2-methylpropyl)propan-1-amine;hydrochloride?
The InChIKey is JHBBVSNPCAYYIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H27N.ClH/c1-10(2)7-13(8-11(3)4)9-12(5)6;/h10-12H,7-9H2,1-6H3;1H.
What are the key properties of 2-methyl-N,N-bis(2-methylpropyl)propan-1-amine;hydrochloride?
2-methyl-N,N-bis(2-methylpropyl)propan-1-amine;hydrochloride has a molecular weight of 221.82 g/mol, XLogP of 3.68, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-N,N-bis(2-methylpropyl)propan-1-amine;hydrochloride is sourced from PubChem (CID 18314135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).