About 3-hydroxy-1,5,5-trimethylimidazolidine-2,4-dione
3-hydroxy-1,5,5-trimethylimidazolidine-2,4-dione (PubChem CID 18314235) has the molecular formula C6H10N2O3
and a molecular weight of 158.16 g/mol. Its IUPAC name is 3-hydroxy-1,5,5-trimethylimidazolidine-2,4-dione.
Molecular Properties
| Compound Name | 3-hydroxy-1,5,5-trimethylimidazolidine-2,4-dione |
| PubChem CID | 18314235 |
| Molecular Formula | C6H10N2O3 |
| Molecular Weight | 158.16 g/mol |
| Exact Mass | 158.07 |
| IUPAC Name | 3-hydroxy-1,5,5-trimethylimidazolidine-2,4-dione |
| SMILES | CN1C(=O)N(O)C(=O)C1(C)C |
| InChI | InChI=1S/C6H10N2O3/c1-6(2)4(9)8(11)5(10)7(6)3/h11H,1-3H3 |
| InChIKey | XHCUOVSAOYQUEV-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.16 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroxy-1,5,5-trimethylimidazolidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-1,5,5-trimethylimidazolidine-2,4-dione?
The IUPAC name of 3-hydroxy-1,5,5-trimethylimidazolidine-2,4-dione (CID 18314235) is 3-hydroxy-1,5,5-trimethylimidazolidine-2,4-dione.
What is the SMILES notation for 3-hydroxy-1,5,5-trimethylimidazolidine-2,4-dione?
The canonical SMILES for 3-hydroxy-1,5,5-trimethylimidazolidine-2,4-dione is CN1C(=O)N(O)C(=O)C1(C)C.
What is the InChIKey of 3-hydroxy-1,5,5-trimethylimidazolidine-2,4-dione?
The InChIKey is XHCUOVSAOYQUEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2O3/c1-6(2)4(9)8(11)5(10)7(6)3/h11H,1-3H3.
What are the key properties of 3-hydroxy-1,5,5-trimethylimidazolidine-2,4-dione?
3-hydroxy-1,5,5-trimethylimidazolidine-2,4-dione has a molecular weight of 158.16 g/mol, XLogP of 0.05, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-1,5,5-trimethylimidazolidine-2,4-dione is sourced from PubChem (CID 18314235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).