C10H19N3O — CID 18314261
1-methyl-3-piperidin-4-yl-1,3-diazinan-2-one (PubChem CID 18314261) has the molecular formula C10H19N3O and a molecular weight of 197.28 g/mol. Its IUPAC name is 1-methyl-3-piperidin-4-yl-1,3-diazinan-2-one.
| Compound Name | 1-methyl-3-piperidin-4-yl-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 18314261 |
| Molecular Formula | C10H19N3O |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.15 |
| IUPAC Name | 1-methyl-3-piperidin-4-yl-1,3-diazinan-2-one |
| SMILES | CN1CCCN(C2CCNCC2)C1=O |
| InChI | InChI=1S/C10H19N3O/c1-12-7-2-8-13(10(12)14)9-3-5-11-6-4-9/h9,11H,2-8H2,1H3 |
| InChIKey | DXRIZBVZZKKYJU-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |