C11H21N3O — CID 18314274
1-ethyl-3-piperidin-4-yl-1,3-diazinan-2-one (PubChem CID 18314274) has the molecular formula C11H21N3O and a molecular weight of 211.31 g/mol. Its IUPAC name is 1-ethyl-3-piperidin-4-yl-1,3-diazinan-2-one.
| Compound Name | 1-ethyl-3-piperidin-4-yl-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 18314274 |
| Molecular Formula | C11H21N3O |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.17 |
| IUPAC Name | 1-ethyl-3-piperidin-4-yl-1,3-diazinan-2-one |
| SMILES | CCN1CCCN(C2CCNCC2)C1=O |
| InChI | InChI=1S/C11H21N3O/c1-2-13-8-3-9-14(11(13)15)10-4-6-12-7-5-10/h10,12H,2-9H2,1H3 |
| InChIKey | UKVNVUSJWJGCNU-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |