About 4-methylhexane-1,3-diamine
4-methylhexane-1,3-diamine (PubChem CID 18314362) has the molecular formula C7H18N2
and a molecular weight of 130.24 g/mol. Its IUPAC name is 4-methylhexane-1,3-diamine.
Molecular Properties
| Compound Name | 4-methylhexane-1,3-diamine |
| PubChem CID | 18314362 |
| Molecular Formula | C7H18N2 |
| Molecular Weight | 130.24 g/mol |
| Exact Mass | 130.15 |
| IUPAC Name | 4-methylhexane-1,3-diamine |
| SMILES | CCC(C)C(N)CCN |
| InChI | InChI=1S/C7H18N2/c1-3-6(2)7(9)4-5-8/h6-7H,3-5,8-9H2,1-2H3 |
| InChIKey | HKTQMCDAQDHXDJ-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.24 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methylhexane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylhexane-1,3-diamine?
The IUPAC name of 4-methylhexane-1,3-diamine (CID 18314362) is 4-methylhexane-1,3-diamine.
What is the SMILES notation for 4-methylhexane-1,3-diamine?
The canonical SMILES for 4-methylhexane-1,3-diamine is CCC(C)C(N)CCN.
What is the InChIKey of 4-methylhexane-1,3-diamine?
The InChIKey is HKTQMCDAQDHXDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H18N2/c1-3-6(2)7(9)4-5-8/h6-7H,3-5,8-9H2,1-2H3.
What are the key properties of 4-methylhexane-1,3-diamine?
4-methylhexane-1,3-diamine has a molecular weight of 130.24 g/mol, XLogP of 0.71, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylhexane-1,3-diamine is sourced from PubChem (CID 18314362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).