C10H12NO4- — CID 18314380
7,7-dimethoxybicyclo[3.1.1]hepta-1(6),2,4-triene carbamate (PubChem CID 18314380) has the molecular formula C10H12NO4- and a molecular weight of 210.21 g/mol. Its IUPAC name is 7,7-dimethoxybicyclo[3.1.1]hepta-1(6),2,4-triene carbamate.
| Compound Name | 7,7-dimethoxybicyclo[3.1.1]hepta-1(6),2,4-triene carbamate |
|---|---|
| PubChem CID | 18314380 |
| Molecular Formula | C10H12NO4- |
| Molecular Weight | 210.21 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | 7,7-dimethoxybicyclo[3.1.1]hepta-1(6),2,4-triene carbamate |
| SMILES | COC1(OC)c2cccc1c2.NC(=O)[O-] |
| InChI | InChI=1S/C9H10O2.CH3NO2/c1-10-9(11-2)7-4-3-5-8(9)6-7;2-1(3)4/h3-6H,1-2H3;2H2,(H,3,4)/p-1 |
| InChIKey | XJMWSLHAMMVKLZ-UHFFFAOYSA-M |
| XLogP | -0.22 |
| TPSA | 84.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.21 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|