C18H21N5O — CID 18314531
7-cyclobutyl-N-(2-methoxyethyl)-3-phenyl-[1,2,4]triazolo[4,3-b]pyridazin-6-amine (PubChem CID 18314531) has the molecular formula C18H21N5O and a molecular weight of 323.40 g/mol. Its IUPAC name is 7-cyclobutyl-N-(2-methoxyethyl)-3-phenyl-[1,2,4]triazolo[4,3-b]pyridazin-6-amine.
| Compound Name | 7-cyclobutyl-N-(2-methoxyethyl)-3-phenyl-[1,2,4]triazolo[4,3-b]pyridazin-6-amine |
|---|---|
| PubChem CID | 18314531 |
| Molecular Formula | C18H21N5O |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | 7-cyclobutyl-N-(2-methoxyethyl)-3-phenyl-[1,2,4]triazolo[4,3-b]pyridazin-6-amine |
| SMILES | COCCNc1nn2c(-c3ccccc3)nnc2cc1C1CCC1 |
| InChI | InChI=1S/C18H21N5O/c1-24-11-10-19-17-15(13-8-5-9-13)12-16-20-21-18(23(16)22-17)14-6-3-2-4-7-14/h2-4,6-7,12-13H,5,8-11H2,1H3,(H,19,22) |
| InChIKey | IECSLJNCQMPULC-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 64.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|