About 1-(sulfinatoamino)butane
1-(sulfinatoamino)butane (PubChem CID 18314787) has the molecular formula C4H10NO2S-
and a molecular weight of 136.20 g/mol. Its IUPAC name is 1-(sulfinatoamino)butane.
Molecular Properties
| Compound Name | 1-(sulfinatoamino)butane |
| PubChem CID | 18314787 |
| Molecular Formula | C4H10NO2S- |
| Molecular Weight | 136.20 g/mol |
| Exact Mass | 136.04 |
| IUPAC Name | 1-(sulfinatoamino)butane |
| SMILES | CCCCNS(=O)[O-] |
| InChI | InChI=1S/C4H11NO2S/c1-2-3-4-5-8(6)7/h5H,2-4H2,1H3,(H,6,7)/p-1 |
| InChIKey | TZFVREKTQBKOHZ-UHFFFAOYSA-M |
| XLogP | 0.17 |
| TPSA | 52.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.20 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 1-(sulfinatoamino)butane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(sulfinatoamino)butane?
The IUPAC name of 1-(sulfinatoamino)butane (CID 18314787) is 1-(sulfinatoamino)butane.
What is the SMILES notation for 1-(sulfinatoamino)butane?
The canonical SMILES for 1-(sulfinatoamino)butane is CCCCNS(=O)[O-].
What is the InChIKey of 1-(sulfinatoamino)butane?
The InChIKey is TZFVREKTQBKOHZ-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H11NO2S/c1-2-3-4-5-8(6)7/h5H,2-4H2,1H3,(H,6,7)/p-1.
What are the key properties of 1-(sulfinatoamino)butane?
1-(sulfinatoamino)butane has a molecular weight of 136.20 g/mol, XLogP of 0.17, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(sulfinatoamino)butane is sourced from PubChem (CID 18314787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).