About 2H-naphthalen-4a-ol
2H-naphthalen-4a-ol (PubChem CID 18314803) has the molecular formula C10H10O
and a molecular weight of 146.19 g/mol. Its IUPAC name is 2H-naphthalen-4a-ol.
Molecular Properties
| Compound Name | 2H-naphthalen-4a-ol |
| PubChem CID | 18314803 |
| Molecular Formula | C10H10O |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.07 |
| IUPAC Name | 2H-naphthalen-4a-ol |
| SMILES | OC12C=CC=CC1=CCC=C2 |
| InChI | InChI=1S/C10H10O/c11-10-7-3-1-5-9(10)6-2-4-8-10/h1,3-8,11H,2H2 |
| InChIKey | NFEKKBUKKCRZIS-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2H-naphthalen-4a-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-naphthalen-4a-ol?
The IUPAC name of 2H-naphthalen-4a-ol (CID 18314803) is 2H-naphthalen-4a-ol.
What is the SMILES notation for 2H-naphthalen-4a-ol?
The canonical SMILES for 2H-naphthalen-4a-ol is OC12C=CC=CC1=CCC=C2.
What is the InChIKey of 2H-naphthalen-4a-ol?
The InChIKey is NFEKKBUKKCRZIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O/c11-10-7-3-1-5-9(10)6-2-4-8-10/h1,3-8,11H,2H2.
What are the key properties of 2H-naphthalen-4a-ol?
2H-naphthalen-4a-ol has a molecular weight of 146.19 g/mol, XLogP of 1.73, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-naphthalen-4a-ol is sourced from PubChem (CID 18314803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).