About tetrakis(3-fluorophenyl)boranuide;tributylazanium
tetrakis(3-fluorophenyl)boranuide;tributylazanium (PubChem CID 18315036) has the molecular formula C36H44BF4N
and a molecular weight of 577.56 g/mol. Its IUPAC name is tetrakis(3-fluorophenyl)boranuide;tributylazanium.
Molecular Properties
| Compound Name | tetrakis(3-fluorophenyl)boranuide;tributylazanium |
| PubChem CID | 18315036 |
| Molecular Formula | C36H44BF4N |
| Molecular Weight | 577.56 g/mol |
| Exact Mass | 577.35 |
| IUPAC Name | tetrakis(3-fluorophenyl)boranuide;tributylazanium |
| SMILES | CCCC[NH+](CCCC)CCCC.Fc1cccc([B-](c2cccc(F)c2)(c2cccc(F)c2)c2cccc(F)c2)c1 |
| InChI | InChI=1S/C24H16BF4.C12H27N/c26-21-9-1-5-17(13-21)25(18-6-2-10-22(27)14-18,19-7-3-11-23(28)15-19)20-8-4-12-24(29)16-20;1-4-7-10-13(11-8-5-2)12-9-6-3/h1-16H;4-12H2,1-3H3/q-1;/p+1 |
| InChIKey | RIZJEHOAWBGJTE-UHFFFAOYSA-O |
| XLogP | 5.89 |
| TPSA | 4.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 577.56 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tetrakis(3-fluorophenyl)boranuide;tributylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetrakis(3-fluorophenyl)boranuide;tributylazanium?
The IUPAC name of tetrakis(3-fluorophenyl)boranuide;tributylazanium (CID 18315036) is tetrakis(3-fluorophenyl)boranuide;tributylazanium.
What is the SMILES notation for tetrakis(3-fluorophenyl)boranuide;tributylazanium?
The canonical SMILES for tetrakis(3-fluorophenyl)boranuide;tributylazanium is CCCC[NH+](CCCC)CCCC.Fc1cccc([B-](c2cccc(F)c2)(c2cccc(F)c2)c2cccc(F)c2)c1.
What is the InChIKey of tetrakis(3-fluorophenyl)boranuide;tributylazanium?
The InChIKey is RIZJEHOAWBGJTE-UHFFFAOYSA-O. The full InChI is InChI=1S/C24H16BF4.C12H27N/c26-21-9-1-5-17(13-21)25(18-6-2-10-22(27)14-18,19-7-3-11-23(28)15-19)20-8-4-12-24(29)16-20;1-4-7-10-13(11-8-5-2)12-9-6-3/h1-16H;4-12H2,1-3H3/q-1;/p+1.
What are the key properties of tetrakis(3-fluorophenyl)boranuide;tributylazanium?
tetrakis(3-fluorophenyl)boranuide;tributylazanium has a molecular weight of 577.56 g/mol, XLogP of 5.89, 13 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tetrakis(3-fluorophenyl)boranuide;tributylazanium is sourced from PubChem (CID 18315036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).