About 4-methyl-1,3-thiazole-2-carboximidamide;hydrochloride
4-methyl-1,3-thiazole-2-carboximidamide;hydrochloride (PubChem CID 18315699) has the molecular formula C5H8ClN3S
and a molecular weight of 177.66 g/mol. Its IUPAC name is 4-methyl-1,3-thiazole-2-carboximidamide;hydrochloride.
Molecular Properties
| Compound Name | 4-methyl-1,3-thiazole-2-carboximidamide;hydrochloride |
| PubChem CID | 18315699 |
| Molecular Formula | C5H8ClN3S |
| Molecular Weight | 177.66 g/mol |
| Exact Mass | 177.01 |
| IUPAC Name | 4-methyl-1,3-thiazole-2-carboximidamide;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1nc(C)cs1 |
| InChI | InChI=1S/C5H7N3S.ClH/c1-3-2-9-5(8-3)4(6)7;/h2H,1H3,(H3,6,7);1H |
| InChIKey | WIMSLPMGWNGYHX-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 62.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.66 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-1,3-thiazole-2-carboximidamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-1,3-thiazole-2-carboximidamide;hydrochloride?
The IUPAC name of 4-methyl-1,3-thiazole-2-carboximidamide;hydrochloride (CID 18315699) is 4-methyl-1,3-thiazole-2-carboximidamide;hydrochloride.
What is the SMILES notation for 4-methyl-1,3-thiazole-2-carboximidamide;hydrochloride?
The canonical SMILES for 4-methyl-1,3-thiazole-2-carboximidamide;hydrochloride is Cl.[H]/N=C(\N)c1nc(C)cs1.
What is the InChIKey of 4-methyl-1,3-thiazole-2-carboximidamide;hydrochloride?
The InChIKey is WIMSLPMGWNGYHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7N3S.ClH/c1-3-2-9-5(8-3)4(6)7;/h2H,1H3,(H3,6,7);1H.
What are the key properties of 4-methyl-1,3-thiazole-2-carboximidamide;hydrochloride?
4-methyl-1,3-thiazole-2-carboximidamide;hydrochloride has a molecular weight of 177.66 g/mol, XLogP of 1.16, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-1,3-thiazole-2-carboximidamide;hydrochloride is sourced from PubChem (CID 18315699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).