C20H29ClN4 — CID 18315779
N-butyl-4,5-dimethyl-6-(1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)pyrimidin-2-amine;hydrochloride (PubChem CID 18315779) has the molecular formula C20H29ClN4 and a molecular weight of 360.93 g/mol. Its IUPAC name is N-butyl-4,5-dimethyl-6-(1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)pyrimidin-2-amine;hydrochloride.
| Compound Name | N-butyl-4,5-dimethyl-6-(1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)pyrimidin-2-amine;hydrochloride |
|---|---|
| PubChem CID | 18315779 |
| Molecular Formula | C20H29ClN4 |
| Molecular Weight | 360.93 g/mol |
| Exact Mass | 360.21 |
| IUPAC Name | N-butyl-4,5-dimethyl-6-(1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)pyrimidin-2-amine;hydrochloride |
| SMILES | CCCCNc1nc(C)c(C)c(N2CCc3ccccc3C2C)n1.Cl |
| InChI | InChI=1S/C20H28N4.ClH/c1-5-6-12-21-20-22-15(3)14(2)19(23-20)24-13-11-17-9-7-8-10-18(17)16(24)4;/h7-10,16H,5-6,11-13H2,1-4H3,(H,21,22,23);1H |
| InChIKey | KWBOCIMQNXGNRM-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.93 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|