About 1-methyl-3-(4-methyl-1,3-thiazol-2-yl)-5,6-diphenylpyridin-2-one
1-methyl-3-(4-methyl-1,3-thiazol-2-yl)-5,6-diphenylpyridin-2-one (PubChem CID 18315857) has the molecular formula C22H18N2OS
and a molecular weight of 358.47 g/mol. Its IUPAC name is 1-methyl-3-(4-methyl-1,3-thiazol-2-yl)-5,6-diphenylpyridin-2-one.
Molecular Properties
| Compound Name | 1-methyl-3-(4-methyl-1,3-thiazol-2-yl)-5,6-diphenylpyridin-2-one |
| PubChem CID | 18315857 |
| Molecular Formula | C22H18N2OS |
| Molecular Weight | 358.47 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | 1-methyl-3-(4-methyl-1,3-thiazol-2-yl)-5,6-diphenylpyridin-2-one |
| SMILES | Cc1csc(-c2cc(-c3ccccc3)c(-c3ccccc3)n(C)c2=O)n1 |
| InChI | InChI=1S/C22H18N2OS/c1-15-14-26-21(23-15)19-13-18(16-9-5-3-6-10-16)20(24(2)22(19)25)17-11-7-4-8-12-17/h3-14H,1-2H3 |
| InChIKey | SJHPUDUENBLPEV-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 358.47 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-methyl-3-(4-methyl-1,3-thiazol-2-yl)-5,6-diphenylpyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-3-(4-methyl-1,3-thiazol-2-yl)-5,6-diphenylpyridin-2-one?
The IUPAC name of 1-methyl-3-(4-methyl-1,3-thiazol-2-yl)-5,6-diphenylpyridin-2-one (CID 18315857) is 1-methyl-3-(4-methyl-1,3-thiazol-2-yl)-5,6-diphenylpyridin-2-one.
What is the SMILES notation for 1-methyl-3-(4-methyl-1,3-thiazol-2-yl)-5,6-diphenylpyridin-2-one?
The canonical SMILES for 1-methyl-3-(4-methyl-1,3-thiazol-2-yl)-5,6-diphenylpyridin-2-one is Cc1csc(-c2cc(-c3ccccc3)c(-c3ccccc3)n(C)c2=O)n1.
What is the InChIKey of 1-methyl-3-(4-methyl-1,3-thiazol-2-yl)-5,6-diphenylpyridin-2-one?
The InChIKey is SJHPUDUENBLPEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H18N2OS/c1-15-14-26-21(23-15)19-13-18(16-9-5-3-6-10-16)20(24(2)22(19)25)17-11-7-4-8-12-17/h3-14H,1-2H3.
What are the key properties of 1-methyl-3-(4-methyl-1,3-thiazol-2-yl)-5,6-diphenylpyridin-2-one?
1-methyl-3-(4-methyl-1,3-thiazol-2-yl)-5,6-diphenylpyridin-2-one has a molecular weight of 358.47 g/mol, XLogP of 5.15, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3-(4-methyl-1,3-thiazol-2-yl)-5,6-diphenylpyridin-2-one is sourced from PubChem (CID 18315857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).