C8H10S — CID 18315883
2,3,4,5-tetrahydro-1-benzothiophene (PubChem CID 18315883) has the molecular formula C8H10S and a molecular weight of 138.24 g/mol. Its IUPAC name is 2,3,4,5-tetrahydro-1-benzothiophene.
| Compound Name | 2,3,4,5-tetrahydro-1-benzothiophene |
|---|---|
| PubChem CID | 18315883 |
| Molecular Formula | C8H10S |
| Molecular Weight | 138.24 g/mol |
| Exact Mass | 138.05 |
| IUPAC Name | 2,3,4,5-tetrahydro-1-benzothiophene |
| SMILES | C1=CC2=C(CC1)CCS2 |
| InChI | InChI=1S/C8H10S/c1-2-4-8-7(3-1)5-6-9-8/h2,4H,1,3,5-6H2 |
| InChIKey | KTHDRSYKYMKNEY-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.24 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |