C25H23N3O4S — CID 18316599
5-[[4-[2-[(E)-1-(4-pyridin-2-ylphenyl)ethylideneamino]oxyethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 18316599) has the molecular formula C25H23N3O4S and a molecular weight of 461.54 g/mol. Its IUPAC name is 5-[[4-[2-[(E)-1-(4-pyridin-2-ylphenyl)ethylideneamino]oxyethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-[2-[(E)-1-(4-pyridin-2-ylphenyl)ethylideneamino]oxyethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 18316599 |
| Molecular Formula | C25H23N3O4S |
| Molecular Weight | 461.54 g/mol |
| Exact Mass | 461.14 |
| IUPAC Name | 5-[[4-[2-[(E)-1-(4-pyridin-2-ylphenyl)ethylideneamino]oxyethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | C/C(=N\OCCOc1ccc(CC2SC(=O)NC2=O)cc1)c1ccc(-c2ccccn2)cc1 |
| InChI | InChI=1S/C25H23N3O4S/c1-17(19-7-9-20(10-8-19)22-4-2-3-13-26-22)28-32-15-14-31-21-11-5-18(6-12-21)16-23-24(29)27-25(30)33-23/h2-13,23H,14-16H2,1H3,(H,27,29,30)/b28-17+ |
| InChIKey | AMEWCLDVKLXCCZ-OGLMXYFKSA-N |
| XLogP | 4.46 |
| TPSA | 89.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.54 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|